C18H22ClNO5S — CID 119257303
1-[1-(4-chlorophenyl)sulfonylcyclopentanecarbonyl]-3-methylpyrrolidine-3-carboxylic acid (PubChem CID 119257303) has the molecular formula C18H22ClNO5S and a molecular weight of 399.90 g/mol. Its IUPAC name is 1-[1-(4-chlorophenyl)sulfonylcyclopentanecarbonyl]-3-methylpyrrolidine-3-carboxylic acid.
| Compound Name | 1-[1-(4-chlorophenyl)sulfonylcyclopentanecarbonyl]-3-methylpyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 119257303 |
| Molecular Formula | C18H22ClNO5S |
| Molecular Weight | 399.90 g/mol |
| Exact Mass | 399.09 |
| IUPAC Name | 1-[1-(4-chlorophenyl)sulfonylcyclopentanecarbonyl]-3-methylpyrrolidine-3-carboxylic acid |
| SMILES | CC1(C(=O)O)CCN(C(=O)C2(S(=O)(=O)c3ccc(Cl)cc3)CCCC2)C1 |
| InChI | InChI=1S/C18H22ClNO5S/c1-17(16(22)23)10-11-20(12-17)15(21)18(8-2-3-9-18)26(24,25)14-6-4-13(19)5-7-14/h4-7H,2-3,8-12H2,1H3,(H,22,23) |
| InChIKey | JJYBYAMOJHPLFQ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.90 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |