C24H27ClN2O4S — CID 55456430
1-[4-[4-[1-(4-chlorophenyl)sulfonylcyclopentanecarbonyl]piperazin-1-yl]phenyl]ethanone (PubChem CID 55456430) has the molecular formula C24H27ClN2O4S and a molecular weight of 475.01 g/mol. Its IUPAC name is 1-[4-[4-[1-(4-chlorophenyl)sulfonylcyclopentanecarbonyl]piperazin-1-yl]phenyl]ethanone.
| Compound Name | 1-[4-[4-[1-(4-chlorophenyl)sulfonylcyclopentanecarbonyl]piperazin-1-yl]phenyl]ethanone |
|---|---|
| PubChem CID | 55456430 |
| Molecular Formula | C24H27ClN2O4S |
| Molecular Weight | 475.01 g/mol |
| Exact Mass | 474.14 |
| IUPAC Name | 1-[4-[4-[1-(4-chlorophenyl)sulfonylcyclopentanecarbonyl]piperazin-1-yl]phenyl]ethanone |
| SMILES | CC(=O)c1ccc(N2CCN(C(=O)C3(S(=O)(=O)c4ccc(Cl)cc4)CCCC3)CC2)cc1 |
| InChI | InChI=1S/C24H27ClN2O4S/c1-18(28)19-4-8-21(9-5-19)26-14-16-27(17-15-26)23(29)24(12-2-3-13-24)32(30,31)22-10-6-20(25)7-11-22/h4-11H,2-3,12-17H2,1H3 |
| InChIKey | ZGBITEBZFAVSMJ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.01 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |