C18H23ClN2O3S — CID 120657499
[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[1-(4-chlorophenyl)sulfonylcyclopentyl]methanone (PubChem CID 120657499) has the molecular formula C18H23ClN2O3S and a molecular weight of 382.91 g/mol. Its IUPAC name is [(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[1-(4-chlorophenyl)sulfonylcyclopentyl]methanone.
| Compound Name | [(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[1-(4-chlorophenyl)sulfonylcyclopentyl]methanone |
|---|---|
| PubChem CID | 120657499 |
| Molecular Formula | C18H23ClN2O3S |
| Molecular Weight | 382.91 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | [(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[1-(4-chlorophenyl)sulfonylcyclopentyl]methanone |
| SMILES | O=C(N1C[C@H]2CNC[C@H]2C1)C1(S(=O)(=O)c2ccc(Cl)cc2)CCCC1 |
| InChI | InChI=1S/C18H23ClN2O3S/c19-15-3-5-16(6-4-15)25(23,24)18(7-1-2-8-18)17(22)21-11-13-9-20-10-14(13)12-21/h3-6,13-14,20H,1-2,7-12H2/t13-,14+ |
| InChIKey | IUHZFNITHGQTLK-OKILXGFUSA-N |
| XLogP | 2.10 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.91 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |