C21H24ClN3O3S — CID 124965144
[1-(4-chlorophenyl)sulfonylcyclopentyl]-[(3R)-3-pyrazin-2-ylpiperidin-1-yl]methanone (PubChem CID 124965144) has the molecular formula C21H24ClN3O3S and a molecular weight of 433.96 g/mol. Its IUPAC name is [1-(4-chlorophenyl)sulfonylcyclopentyl]-[(3R)-3-pyrazin-2-ylpiperidin-1-yl]methanone.
| Compound Name | [1-(4-chlorophenyl)sulfonylcyclopentyl]-[(3R)-3-pyrazin-2-ylpiperidin-1-yl]methanone |
|---|---|
| PubChem CID | 124965144 |
| Molecular Formula | C21H24ClN3O3S |
| Molecular Weight | 433.96 g/mol |
| Exact Mass | 433.12 |
| IUPAC Name | [1-(4-chlorophenyl)sulfonylcyclopentyl]-[(3R)-3-pyrazin-2-ylpiperidin-1-yl]methanone |
| SMILES | O=C(N1CCC[C@@H](c2cnccn2)C1)C1(S(=O)(=O)c2ccc(Cl)cc2)CCCC1 |
| InChI | InChI=1S/C21H24ClN3O3S/c22-17-5-7-18(8-6-17)29(27,28)21(9-1-2-10-21)20(26)25-13-3-4-16(15-25)19-14-23-11-12-24-19/h5-8,11-12,14,16H,1-4,9-10,13,15H2/t16-/m1/s1 |
| InChIKey | ICTAZZDYEJSSSS-MRXNPFEDSA-N |
| XLogP | 3.62 |
| TPSA | 80.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.96 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |