C17H24Cl2N2O3S — CID 119377853
(3-aminopiperidin-1-yl)-[1-(4-chlorophenyl)sulfonylcyclopentyl]methanone;hydrochloride (PubChem CID 119377853) has the molecular formula C17H24Cl2N2O3S and a molecular weight of 407.36 g/mol. Its IUPAC name is (3-aminopiperidin-1-yl)-[1-(4-chlorophenyl)sulfonylcyclopentyl]methanone;hydrochloride.
| Compound Name | (3-aminopiperidin-1-yl)-[1-(4-chlorophenyl)sulfonylcyclopentyl]methanone;hydrochloride |
|---|---|
| PubChem CID | 119377853 |
| Molecular Formula | C17H24Cl2N2O3S |
| Molecular Weight | 407.36 g/mol |
| Exact Mass | 406.09 |
| IUPAC Name | (3-aminopiperidin-1-yl)-[1-(4-chlorophenyl)sulfonylcyclopentyl]methanone;hydrochloride |
| SMILES | Cl.NC1CCCN(C(=O)C2(S(=O)(=O)c3ccc(Cl)cc3)CCCC2)C1 |
| InChI | InChI=1S/C17H23ClN2O3S.ClH/c18-13-5-7-15(8-6-13)24(22,23)17(9-1-2-10-17)16(21)20-11-3-4-14(19)12-20;/h5-8,14H,1-4,9-12,19H2;1H |
| InChIKey | PDUKEWUUYABPLU-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.36 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |