C20H29F3N2O3 — CID 112811006
N-[2-(2-methoxyethoxy)-5-(trifluoromethyl)phenyl]-2-[(2-methylcyclohexyl)amino]propanamide (PubChem CID 112811006) has the molecular formula C20H29F3N2O3 and a molecular weight of 402.46 g/mol. Its IUPAC name is N-[2-(2-methoxyethoxy)-5-(trifluoromethyl)phenyl]-2-[(2-methylcyclohexyl)amino]propanamide.
| Compound Name | N-[2-(2-methoxyethoxy)-5-(trifluoromethyl)phenyl]-2-[(2-methylcyclohexyl)amino]propanamide |
|---|---|
| PubChem CID | 112811006 |
| Molecular Formula | C20H29F3N2O3 |
| Molecular Weight | 402.46 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | N-[2-(2-methoxyethoxy)-5-(trifluoromethyl)phenyl]-2-[(2-methylcyclohexyl)amino]propanamide |
| SMILES | COCCOc1ccc(C(F)(F)F)cc1NC(=O)C(C)NC1CCCCC1C |
| InChI | InChI=1S/C20H29F3N2O3/c1-13-6-4-5-7-16(13)24-14(2)19(26)25-17-12-15(20(21,22)23)8-9-18(17)28-11-10-27-3/h8-9,12-14,16,24H,4-7,10-11H2,1-3H3,(H,25,26) |
| InChIKey | VAYJVGMIJRCHFP-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.46 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|