C24H48O4Si2 — CID 11282503
propan-2-yl (2E,4S,5S,6E)-2,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-methylocta-2,6-dienoate (PubChem CID 11282503) has the molecular formula C24H48O4Si2 and a molecular weight of 456.82 g/mol. Its IUPAC name is propan-2-yl (2E,4S,5S,6E)-2,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-methylocta-2,6-dienoate.
| Compound Name | propan-2-yl (2E,4S,5S,6E)-2,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-methylocta-2,6-dienoate |
|---|---|
| PubChem CID | 11282503 |
| Molecular Formula | C24H48O4Si2 |
| Molecular Weight | 456.82 g/mol |
| Exact Mass | 456.31 |
| IUPAC Name | propan-2-yl (2E,4S,5S,6E)-2,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-methylocta-2,6-dienoate |
| SMILES | C/C=C/[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)/C=C(/O[Si](C)(C)C(C)(C)C)C(=O)OC(C)C |
| InChI | InChI=1S/C24H48O4Si2/c1-15-16-20(27-29(11,12)23(5,6)7)19(4)17-21(22(25)26-18(2)3)28-30(13,14)24(8,9)10/h15-20H,1-14H3/b16-15+,21-17+/t19-,20-/m0/s1 |
| InChIKey | ILWYXWZQEFBEML-OPANTOSJSA-N |
| XLogP | 7.45 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.82 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|