C23H38N4O2 — CID 112835935
N-[[4-[2-(diethylamino)ethoxy]phenyl]methyl]-4-pyrrolidin-1-ylpiperidine-1-carboxamide (PubChem CID 112835935) has the molecular formula C23H38N4O2 and a molecular weight of 402.58 g/mol. Its IUPAC name is N-[[4-[2-(diethylamino)ethoxy]phenyl]methyl]-4-pyrrolidin-1-ylpiperidine-1-carboxamide.
| Compound Name | N-[[4-[2-(diethylamino)ethoxy]phenyl]methyl]-4-pyrrolidin-1-ylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 112835935 |
| Molecular Formula | C23H38N4O2 |
| Molecular Weight | 402.58 g/mol |
| Exact Mass | 402.30 |
| IUPAC Name | N-[[4-[2-(diethylamino)ethoxy]phenyl]methyl]-4-pyrrolidin-1-ylpiperidine-1-carboxamide |
| SMILES | CCN(CC)CCOc1ccc(CNC(=O)N2CCC(N3CCCC3)CC2)cc1 |
| InChI | InChI=1S/C23H38N4O2/c1-3-25(4-2)17-18-29-22-9-7-20(8-10-22)19-24-23(28)27-15-11-21(12-16-27)26-13-5-6-14-26/h7-10,21H,3-6,11-19H2,1-2H3,(H,24,28) |
| InChIKey | WZVAPHKPPSZWFY-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 48.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.58 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |