C14H23NO5SSi — CID 11290925
methyl 2-[furan-2-yl-(2-trimethylsilylethylsulfonylamino)methyl]prop-2-enoate (PubChem CID 11290925) has the molecular formula C14H23NO5SSi and a molecular weight of 345.49 g/mol. Its IUPAC name is methyl 2-[furan-2-yl-(2-trimethylsilylethylsulfonylamino)methyl]prop-2-enoate.
| Compound Name | methyl 2-[furan-2-yl-(2-trimethylsilylethylsulfonylamino)methyl]prop-2-enoate |
|---|---|
| PubChem CID | 11290925 |
| Molecular Formula | C14H23NO5SSi |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | methyl 2-[furan-2-yl-(2-trimethylsilylethylsulfonylamino)methyl]prop-2-enoate |
| SMILES | C=C(C(=O)OC)C(NS(=O)(=O)CC[Si](C)(C)C)c1ccco1 |
| InChI | InChI=1S/C14H23NO5SSi/c1-11(14(16)19-2)13(12-7-6-8-20-12)15-21(17,18)9-10-22(3,4)5/h6-8,13,15H,1,9-10H2,2-5H3 |
| InChIKey | VCMRGAISKSUEDJ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|