C16H25IN4O4SSi — CID 25259560
methyl (2R,3R)-2-(azidomethyl)-3-(2-iodophenyl)-3-(2-trimethylsilylethylsulfonylamino)propanoate (PubChem CID 25259560) has the molecular formula C16H25IN4O4SSi and a molecular weight of 524.46 g/mol. Its IUPAC name is methyl (2R,3R)-2-(azidomethyl)-3-(2-iodophenyl)-3-(2-trimethylsilylethylsulfonylamino)propanoate.
| Compound Name | methyl (2R,3R)-2-(azidomethyl)-3-(2-iodophenyl)-3-(2-trimethylsilylethylsulfonylamino)propanoate |
|---|---|
| PubChem CID | 25259560 |
| Molecular Formula | C16H25IN4O4SSi |
| Molecular Weight | 524.46 g/mol |
| Exact Mass | 524.04 |
| IUPAC Name | methyl (2R,3R)-2-(azidomethyl)-3-(2-iodophenyl)-3-(2-trimethylsilylethylsulfonylamino)propanoate |
| SMILES | COC(=O)[C@H](CN=[N+]=[N-])[C@@H](NS(=O)(=O)CC[Si](C)(C)C)c1ccccc1I |
| InChI | InChI=1S/C16H25IN4O4SSi/c1-25-16(22)13(11-19-21-18)15(12-7-5-6-8-14(12)17)20-26(23,24)9-10-27(2,3)4/h5-8,13,15,20H,9-11H2,1-4H3/t13-,15+/m1/s1 |
| InChIKey | XWJKJXNQAKZUEZ-HIFRSBDPSA-N |
| XLogP | 3.69 |
| TPSA | 121.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.46 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|