C16H25NO3SSi — CID 135059571
N-[(E)-5-oxo-5-phenylpent-3-en-2-yl]-2-trimethylsilylethanesulfonamide (PubChem CID 135059571) has the molecular formula C16H25NO3SSi and a molecular weight of 339.53 g/mol. Its IUPAC name is N-[(E)-5-oxo-5-phenylpent-3-en-2-yl]-2-trimethylsilylethanesulfonamide.
| Compound Name | N-[(E)-5-oxo-5-phenylpent-3-en-2-yl]-2-trimethylsilylethanesulfonamide |
|---|---|
| PubChem CID | 135059571 |
| Molecular Formula | C16H25NO3SSi |
| Molecular Weight | 339.53 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | N-[(E)-5-oxo-5-phenylpent-3-en-2-yl]-2-trimethylsilylethanesulfonamide |
| SMILES | CC(/C=C/C(=O)c1ccccc1)NS(=O)(=O)CC[Si](C)(C)C |
| InChI | InChI=1S/C16H25NO3SSi/c1-14(17-21(19,20)12-13-22(2,3)4)10-11-16(18)15-8-6-5-7-9-15/h5-11,14,17H,12-13H2,1-4H3/b11-10+ |
| InChIKey | WEEJZRNKRXVPJN-ZHACJKMWSA-N |
| XLogP | 3.07 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.53 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|