C21H29N5 — CID 112911296
2-N-[2-(cyclohexen-1-yl)ethyl]-4-N-[4-(dimethylamino)phenyl]-6-methylpyrimidine-2,4-diamine (PubChem CID 112911296) has the molecular formula C21H29N5 and a molecular weight of 351.50 g/mol. Its IUPAC name is 2-N-[2-(cyclohexen-1-yl)ethyl]-4-N-[4-(dimethylamino)phenyl]-6-methylpyrimidine-2,4-diamine.
| Compound Name | 2-N-[2-(cyclohexen-1-yl)ethyl]-4-N-[4-(dimethylamino)phenyl]-6-methylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112911296 |
| Molecular Formula | C21H29N5 |
| Molecular Weight | 351.50 g/mol |
| Exact Mass | 351.24 |
| IUPAC Name | 2-N-[2-(cyclohexen-1-yl)ethyl]-4-N-[4-(dimethylamino)phenyl]-6-methylpyrimidine-2,4-diamine |
| SMILES | Cc1cc(Nc2ccc(N(C)C)cc2)nc(NCCC2=CCCCC2)n1 |
| InChI | InChI=1S/C21H29N5/c1-16-15-20(24-18-9-11-19(12-10-18)26(2)3)25-21(23-16)22-14-13-17-7-5-4-6-8-17/h7,9-12,15H,4-6,8,13-14H2,1-3H3,(H2,22,23,24,25) |
| InChIKey | JIMMMVNNBPDFLB-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.50 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|