C35H50O5 — CID 11295813
(2S,4R,4aS,8R,8aR)-8-[(2R)-1-[(4-methoxyphenyl)methoxy]-3-methylbutan-2-yl]-4-[(2S)-1-[(4-methoxyphenyl)methoxy]propan-2-yl]-6-methyl-1,2,3,4,4a,7,8,8a-octahydronaphthalen-2-ol (PubChem CID 11295813) has the molecular formula C35H50O5 and a molecular weight of 550.78 g/mol. Its IUPAC name is (2S,4R,4aS,8R,8aR)-8-[(2R)-1-[(4-methoxyphenyl)methoxy]-3-methylbutan-2-yl]-4-[(2S)-1-[(4-methoxyphenyl)methoxy]propan-2-yl]-6-methyl-1,2,3,4,4a,7,8,8a-octahydronaphthalen-2-ol.
| Compound Name | (2S,4R,4aS,8R,8aR)-8-[(2R)-1-[(4-methoxyphenyl)methoxy]-3-methylbutan-2-yl]-4-[(2S)-1-[(4-methoxyphenyl)methoxy]propan-2-yl]-6-methyl-1,2,3,4,4a,7,8,8a-octahydronaphthalen-2-ol |
|---|---|
| PubChem CID | 11295813 |
| Molecular Formula | C35H50O5 |
| Molecular Weight | 550.78 g/mol |
| Exact Mass | 550.37 |
| IUPAC Name | (2S,4R,4aS,8R,8aR)-8-[(2R)-1-[(4-methoxyphenyl)methoxy]-3-methylbutan-2-yl]-4-[(2S)-1-[(4-methoxyphenyl)methoxy]propan-2-yl]-6-methyl-1,2,3,4,4a,7,8,8a-octahydronaphthalen-2-ol |
| SMILES | COc1ccc(COC[C@@H](C)[C@@H]2C[C@@H](O)C[C@H]3[C@@H]2C=C(C)C[C@H]3[C@H](COCc2ccc(OC)cc2)C(C)C)cc1 |
| InChI | InChI=1S/C35H50O5/c1-23(2)35(22-40-21-27-9-13-30(38-6)14-10-27)33-16-24(3)15-32-31(17-28(36)18-34(32)33)25(4)19-39-20-26-7-11-29(37-5)12-8-26/h7-15,23,25,28,31-36H,16-22H2,1-6H3/t25-,28-,31+,32-,33-,34+,35-/m1/s1 |
| InChIKey | LGZGYVAWNJWMNC-INWOQVBVSA-N |
| XLogP | 7.32 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.78 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|