C27H38O5 — CID 11487561
(2R)-2-[(1R,4aS,5R,8aR)-5-[(2S)-1-[(4-methoxyphenyl)methoxy]propan-2-yl]-3-methyl-7-oxo-2,4a,5,6,8,8a-hexahydro-1H-naphthalen-1-yl]-3-methylbutanoic acid (PubChem CID 11487561) has the molecular formula C27H38O5 and a molecular weight of 442.60 g/mol. Its IUPAC name is (2R)-2-[(1R,4aS,5R,8aR)-5-[(2S)-1-[(4-methoxyphenyl)methoxy]propan-2-yl]-3-methyl-7-oxo-2,4a,5,6,8,8a-hexahydro-1H-naphthalen-1-yl]-3-methylbutanoic acid.
| Compound Name | (2R)-2-[(1R,4aS,5R,8aR)-5-[(2S)-1-[(4-methoxyphenyl)methoxy]propan-2-yl]-3-methyl-7-oxo-2,4a,5,6,8,8a-hexahydro-1H-naphthalen-1-yl]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 11487561 |
| Molecular Formula | C27H38O5 |
| Molecular Weight | 442.60 g/mol |
| Exact Mass | 442.27 |
| IUPAC Name | (2R)-2-[(1R,4aS,5R,8aR)-5-[(2S)-1-[(4-methoxyphenyl)methoxy]propan-2-yl]-3-methyl-7-oxo-2,4a,5,6,8,8a-hexahydro-1H-naphthalen-1-yl]-3-methylbutanoic acid |
| SMILES | COc1ccc(COC[C@@H](C)[C@@H]2CC(=O)C[C@H]3[C@@H]2C=C(C)C[C@H]3[C@H](C(=O)O)C(C)C)cc1 |
| InChI | InChI=1S/C27H38O5/c1-16(2)26(27(29)30)25-11-17(3)10-23-22(12-20(28)13-24(23)25)18(4)14-32-15-19-6-8-21(31-5)9-7-19/h6-10,16,18,22-26H,11-15H2,1-5H3,(H,29,30)/t18-,22+,23-,24+,25-,26-/m1/s1 |
| InChIKey | BXKHLDUDLRGQCK-ARQMQQCDSA-N |
| XLogP | 5.38 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.60 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|