C28H44O2 — CID 11304495
2,7,8-trimethyl-2-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-4,4a,5,8a-tetrahydro-3H-chromen-6-one (PubChem CID 11304495) has the molecular formula C28H44O2 and a molecular weight of 412.66 g/mol. Its IUPAC name is 2,7,8-trimethyl-2-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-4,4a,5,8a-tetrahydro-3H-chromen-6-one.
| Compound Name | 2,7,8-trimethyl-2-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-4,4a,5,8a-tetrahydro-3H-chromen-6-one |
|---|---|
| PubChem CID | 11304495 |
| Molecular Formula | C28H44O2 |
| Molecular Weight | 412.66 g/mol |
| Exact Mass | 412.33 |
| IUPAC Name | 2,7,8-trimethyl-2-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-4,4a,5,8a-tetrahydro-3H-chromen-6-one |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CCC1(C)CCC2CC(=O)C(C)=C(C)C2O1 |
| InChI | InChI=1S/C28H44O2/c1-20(2)11-8-12-21(3)13-9-14-22(4)15-10-17-28(7)18-16-25-19-26(29)23(5)24(6)27(25)30-28/h11,13,15,25,27H,8-10,12,14,16-19H2,1-7H3/b21-13+,22-15+ |
| InChIKey | IEICLPHKRAXASC-NTZRDTQNSA-N |
| XLogP | 8.05 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.66 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|