C25H42O3Si — CID 11304667
(Z,4S,5S,6S)-4,6-dimethyl-5-[(1S)-1-phenylethoxy]-7-triethylsilyloxynon-7-en-3-one (PubChem CID 11304667) has the molecular formula C25H42O3Si and a molecular weight of 418.69 g/mol. Its IUPAC name is (Z,4S,5S,6S)-4,6-dimethyl-5-[(1S)-1-phenylethoxy]-7-triethylsilyloxynon-7-en-3-one.
| Compound Name | (Z,4S,5S,6S)-4,6-dimethyl-5-[(1S)-1-phenylethoxy]-7-triethylsilyloxynon-7-en-3-one |
|---|---|
| PubChem CID | 11304667 |
| Molecular Formula | C25H42O3Si |
| Molecular Weight | 418.69 g/mol |
| Exact Mass | 418.29 |
| IUPAC Name | (Z,4S,5S,6S)-4,6-dimethyl-5-[(1S)-1-phenylethoxy]-7-triethylsilyloxynon-7-en-3-one |
| SMILES | C/C=C(\O[Si](CC)(CC)CC)[C@@H](C)[C@H](O[C@@H](C)c1ccccc1)[C@H](C)C(=O)CC |
| InChI | InChI=1S/C25H42O3Si/c1-9-23(26)19(6)25(27-21(8)22-17-15-14-16-18-22)20(7)24(10-2)28-29(11-3,12-4)13-5/h10,14-21,25H,9,11-13H2,1-8H3/b24-10-/t19-,20-,21+,25-/m1/s1 |
| InChIKey | ABZURHIZZUSLRD-SVOQKIFOSA-N |
| XLogP | 7.31 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.69 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|