C25H40O5 — CID 53473553
[(Z,4S,5S,6R,7R,8R,9R)-7,9-dihydroxy-4,6,8-trimethyl-5-[(1S)-1-phenylethoxy]dec-2-en-3-yl] 2-methylpropanoate (PubChem CID 53473553) has the molecular formula C25H40O5 and a molecular weight of 420.59 g/mol. Its IUPAC name is [(Z,4S,5S,6R,7R,8R,9R)-7,9-dihydroxy-4,6,8-trimethyl-5-[(1S)-1-phenylethoxy]dec-2-en-3-yl] 2-methylpropanoate.
| Compound Name | [(Z,4S,5S,6R,7R,8R,9R)-7,9-dihydroxy-4,6,8-trimethyl-5-[(1S)-1-phenylethoxy]dec-2-en-3-yl] 2-methylpropanoate |
|---|---|
| PubChem CID | 53473553 |
| Molecular Formula | C25H40O5 |
| Molecular Weight | 420.59 g/mol |
| Exact Mass | 420.29 |
| IUPAC Name | [(Z,4S,5S,6R,7R,8R,9R)-7,9-dihydroxy-4,6,8-trimethyl-5-[(1S)-1-phenylethoxy]dec-2-en-3-yl] 2-methylpropanoate |
| SMILES | C/C=C(\OC(=O)C(C)C)[C@@H](C)[C@@H](O[C@@H](C)c1ccccc1)[C@H](C)[C@H](O)[C@H](C)[C@@H](C)O |
| InChI | InChI=1S/C25H40O5/c1-9-22(30-25(28)15(2)3)17(5)24(18(6)23(27)16(4)19(7)26)29-20(8)21-13-11-10-12-14-21/h9-20,23-24,26-27H,1-8H3/b22-9-/t16-,17-,18-,19-,20+,23-,24-/m1/s1 |
| InChIKey | XPQBXTYNRUBURV-BKJXSGRLSA-N |
| XLogP | 4.89 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.59 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|