C16H16F3N3O — CID 113081654
2,3,4-trifluoro-N-[(1-methyl-4,5,6,7-tetrahydrobenzimidazol-2-yl)methyl]benzamide (PubChem CID 113081654) has the molecular formula C16H16F3N3O and a molecular weight of 323.32 g/mol. Its IUPAC name is 2,3,4-trifluoro-N-[(1-methyl-4,5,6,7-tetrahydrobenzimidazol-2-yl)methyl]benzamide.
| Compound Name | 2,3,4-trifluoro-N-[(1-methyl-4,5,6,7-tetrahydrobenzimidazol-2-yl)methyl]benzamide |
|---|---|
| PubChem CID | 113081654 |
| Molecular Formula | C16H16F3N3O |
| Molecular Weight | 323.32 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | 2,3,4-trifluoro-N-[(1-methyl-4,5,6,7-tetrahydrobenzimidazol-2-yl)methyl]benzamide |
| SMILES | Cn1c(CNC(=O)c2ccc(F)c(F)c2F)nc2c1CCCC2 |
| InChI | InChI=1S/C16H16F3N3O/c1-22-12-5-3-2-4-11(12)21-13(22)8-20-16(23)9-6-7-10(17)15(19)14(9)18/h6-7H,2-5,8H2,1H3,(H,20,23) |
| InChIKey | LAFZKCUOJWDQLN-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.32 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|