C20H22N2O2S — CID 113096741
2-methyl-N-(9-methyl-1,2,3,4-tetrahydrocarbazol-3-yl)benzenesulfonamide (PubChem CID 113096741) has the molecular formula C20H22N2O2S and a molecular weight of 354.48 g/mol. Its IUPAC name is 2-methyl-N-(9-methyl-1,2,3,4-tetrahydrocarbazol-3-yl)benzenesulfonamide.
| Compound Name | 2-methyl-N-(9-methyl-1,2,3,4-tetrahydrocarbazol-3-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 113096741 |
| Molecular Formula | C20H22N2O2S |
| Molecular Weight | 354.48 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | 2-methyl-N-(9-methyl-1,2,3,4-tetrahydrocarbazol-3-yl)benzenesulfonamide |
| SMILES | Cc1ccccc1S(=O)(=O)NC1CCc2c(c3ccccc3n2C)C1 |
| InChI | InChI=1S/C20H22N2O2S/c1-14-7-3-6-10-20(14)25(23,24)21-15-11-12-19-17(13-15)16-8-4-5-9-18(16)22(19)2/h3-10,15,21H,11-13H2,1-2H3 |
| InChIKey | ZAMLRSHIHUCQFT-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.48 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|