C16H26O — CID 11310877
(1S,4R,5R)-3-but-3-enyl-4-methyl-5-propan-2-yl-4-prop-2-enylcyclopent-2-en-1-ol (PubChem CID 11310877) has the molecular formula C16H26O and a molecular weight of 234.38 g/mol. Its IUPAC name is (1S,4R,5R)-3-but-3-enyl-4-methyl-5-propan-2-yl-4-prop-2-enylcyclopent-2-en-1-ol.
| Compound Name | (1S,4R,5R)-3-but-3-enyl-4-methyl-5-propan-2-yl-4-prop-2-enylcyclopent-2-en-1-ol |
|---|---|
| PubChem CID | 11310877 |
| Molecular Formula | C16H26O |
| Molecular Weight | 234.38 g/mol |
| Exact Mass | 234.20 |
| IUPAC Name | (1S,4R,5R)-3-but-3-enyl-4-methyl-5-propan-2-yl-4-prop-2-enylcyclopent-2-en-1-ol |
| SMILES | C=CCCC1=C[C@H](O)[C@H](C(C)C)[C@@]1(C)CC=C |
| InChI | InChI=1S/C16H26O/c1-6-8-9-13-11-14(17)15(12(3)4)16(13,5)10-7-2/h6-7,11-12,14-15,17H,1-2,8-10H2,3-5H3/t14-,15-,16-/m0/s1 |
| InChIKey | PYLDSPKANBQEKL-JYJNAYRXSA-N |
| XLogP | 4.11 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.38 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|