About (7S)-1-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-2,2-dimethyldec-9-en-3-one
(7S)-1-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-2,2-dimethyldec-9-en-3-one (PubChem CID 11313450) has the molecular formula C18H36O3Si
and a molecular weight of 328.57 g/mol. Its IUPAC name is (7S)-1-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-2,2-dimethyldec-9-en-3-one.
Molecular Properties
| Compound Name | (7S)-1-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-2,2-dimethyldec-9-en-3-one |
| PubChem CID | 11313450 |
| Molecular Formula | C18H36O3Si |
| Molecular Weight | 328.57 g/mol |
| Exact Mass | 328.24 |
| IUPAC Name | (7S)-1-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-2,2-dimethyldec-9-en-3-one |
| SMILES | C=CC[C@@H](O)CCCC(=O)C(C)(C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H36O3Si/c1-9-11-15(19)12-10-13-16(20)18(5,6)14-21-22(7,8)17(2,3)4/h9,15,19H,1,10-14H2,2-8H3/t15-/m1/s1 |
| InChIKey | QJBQBOFGXZHUFQ-OAHLLOKOSA-N |
| XLogP | 4.71 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.57 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (7S)-1-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-2,2-dimethyldec-9-en-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7S)-1-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-2,2-dimethyldec-9-en-3-one?
The IUPAC name of (7S)-1-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-2,2-dimethyldec-9-en-3-one (CID 11313450) is (7S)-1-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-2,2-dimethyldec-9-en-3-one.
What is the SMILES notation for (7S)-1-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-2,2-dimethyldec-9-en-3-one?
The canonical SMILES for (7S)-1-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-2,2-dimethyldec-9-en-3-one is C=CC[C@@H](O)CCCC(=O)C(C)(C)CO[Si](C)(C)C(C)(C)C.
What is the InChIKey of (7S)-1-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-2,2-dimethyldec-9-en-3-one?
The InChIKey is QJBQBOFGXZHUFQ-OAHLLOKOSA-N. The full InChI is InChI=1S/C18H36O3Si/c1-9-11-15(19)12-10-13-16(20)18(5,6)14-21-22(7,8)17(2,3)4/h9,15,19H,1,10-14H2,2-8H3/t15-/m1/s1.
What are the key properties of (7S)-1-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-2,2-dimethyldec-9-en-3-one?
(7S)-1-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-2,2-dimethyldec-9-en-3-one has a molecular weight of 328.57 g/mol, XLogP of 4.71, 10 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (7S)-1-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-2,2-dimethyldec-9-en-3-one is sourced from PubChem (CID 11313450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).