C18H36O3Si — CID 11313450
(7S)-1-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-2,2-dimethyldec-9-en-3-one (PubChem CID 11313450) has the molecular formula C18H36O3Si and a molecular weight of 328.57 g/mol. Its IUPAC name is (7S)-1-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-2,2-dimethyldec-9-en-3-one.
| Compound Name | (7S)-1-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-2,2-dimethyldec-9-en-3-one |
|---|---|
| PubChem CID | 11313450 |
| Molecular Formula | C18H36O3Si |
| Molecular Weight | 328.57 g/mol |
| Exact Mass | 328.24 |
| IUPAC Name | (7S)-1-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-2,2-dimethyldec-9-en-3-one |
| SMILES | C=CC[C@@H](O)CCCC(=O)C(C)(C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H36O3Si/c1-9-11-15(19)12-10-13-16(20)18(5,6)14-21-22(7,8)17(2,3)4/h9,15,19H,1,10-14H2,2-8H3/t15-/m1/s1 |
| InChIKey | QJBQBOFGXZHUFQ-OAHLLOKOSA-N |
| XLogP | 4.71 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.57 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|