C27H56O4Si2 — CID 59913498
(3S,6R,7S,8S)-1,3-bis[[tert-butyl(dimethyl)silyl]oxy]-7-hydroxy-4,4,6,8-tetramethylundec-10-en-5-one (PubChem CID 59913498) has the molecular formula C27H56O4Si2 and a molecular weight of 500.91 g/mol. Its IUPAC name is (3S,6R,7S,8S)-1,3-bis[[tert-butyl(dimethyl)silyl]oxy]-7-hydroxy-4,4,6,8-tetramethylundec-10-en-5-one.
| Compound Name | (3S,6R,7S,8S)-1,3-bis[[tert-butyl(dimethyl)silyl]oxy]-7-hydroxy-4,4,6,8-tetramethylundec-10-en-5-one |
|---|---|
| PubChem CID | 59913498 |
| Molecular Formula | C27H56O4Si2 |
| Molecular Weight | 500.91 g/mol |
| Exact Mass | 500.37 |
| IUPAC Name | (3S,6R,7S,8S)-1,3-bis[[tert-butyl(dimethyl)silyl]oxy]-7-hydroxy-4,4,6,8-tetramethylundec-10-en-5-one |
| SMILES | C=CC[C@H](C)[C@H](O)[C@@H](C)C(=O)C(C)(C)[C@H](CCO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H56O4Si2/c1-16-17-20(2)23(28)21(3)24(29)27(10,11)22(31-33(14,15)26(7,8)9)18-19-30-32(12,13)25(4,5)6/h16,20-23,28H,1,17-19H2,2-15H3/t20-,21+,22-,23-/m0/s1 |
| InChIKey | OONOGSVTPAOKEA-BJESRGMDSA-N |
| XLogP | 7.59 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.91 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|