C22H13N5O3 — CID 11315417
(4-nitrophenyl)-(1-phenylpyrazolo[4,3-b]quinoxalin-3-yl)methanone (PubChem CID 11315417) has the molecular formula C22H13N5O3 and a molecular weight of 395.38 g/mol. Its IUPAC name is (4-nitrophenyl)-(1-phenylpyrazolo[4,3-b]quinoxalin-3-yl)methanone.
| Compound Name | (4-nitrophenyl)-(1-phenylpyrazolo[4,3-b]quinoxalin-3-yl)methanone |
|---|---|
| PubChem CID | 11315417 |
| Molecular Formula | C22H13N5O3 |
| Molecular Weight | 395.38 g/mol |
| Exact Mass | 395.10 |
| IUPAC Name | (4-nitrophenyl)-(1-phenylpyrazolo[4,3-b]quinoxalin-3-yl)methanone |
| SMILES | O=C(c1ccc([N+](=O)[O-])cc1)c1nn(-c2ccccc2)c2nc3ccccc3nc12 |
| InChI | InChI=1S/C22H13N5O3/c28-21(14-10-12-16(13-11-14)27(29)30)19-20-22(24-18-9-5-4-8-17(18)23-20)26(25-19)15-6-2-1-3-7-15/h1-13H |
| InChIKey | GZHCHSCPHKKOFZ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 103.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.38 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|