C30H47N3O7 — CID 11318990
tert-butyl (4S)-4-[(3S)-5-[[(2S)-1-methoxy-1-oxo-6-(phenylmethoxycarbonylamino)hexan-2-yl]amino]pent-1-en-3-yl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 11318990) has the molecular formula C30H47N3O7 and a molecular weight of 561.72 g/mol. Its IUPAC name is tert-butyl (4S)-4-[(3S)-5-[[(2S)-1-methoxy-1-oxo-6-(phenylmethoxycarbonylamino)hexan-2-yl]amino]pent-1-en-3-yl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4S)-4-[(3S)-5-[[(2S)-1-methoxy-1-oxo-6-(phenylmethoxycarbonylamino)hexan-2-yl]amino]pent-1-en-3-yl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 11318990 |
| Molecular Formula | C30H47N3O7 |
| Molecular Weight | 561.72 g/mol |
| Exact Mass | 561.34 |
| IUPAC Name | tert-butyl (4S)-4-[(3S)-5-[[(2S)-1-methoxy-1-oxo-6-(phenylmethoxycarbonylamino)hexan-2-yl]amino]pent-1-en-3-yl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | C=C[C@H](CCN[C@@H](CCCCNC(=O)OCc1ccccc1)C(=O)OC)[C@H]1COC(C)(C)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C30H47N3O7/c1-8-23(25-21-39-30(5,6)33(25)28(36)40-29(2,3)4)17-19-31-24(26(34)37-7)16-12-13-18-32-27(35)38-20-22-14-10-9-11-15-22/h8-11,14-15,23-25,31H,1,12-13,16-21H2,2-7H3,(H,32,35)/t23-,24+,25-/m1/s1 |
| InChIKey | ATWBIZLDTRDFOM-DSNGMDLFSA-N |
| XLogP | 4.78 |
| TPSA | 115.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.72 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|