C36H51N3O7 — CID 11456426
tert-butyl (4S)-2,2-dimethyl-4-[(3S)-5-[[(2S)-1-oxo-1-phenylmethoxy-6-(phenylmethoxycarbonylamino)hexan-2-yl]amino]pent-1-en-3-yl]-1,3-oxazolidine-3-carboxylate (PubChem CID 11456426) has the molecular formula C36H51N3O7 and a molecular weight of 637.82 g/mol. Its IUPAC name is tert-butyl (4S)-2,2-dimethyl-4-[(3S)-5-[[(2S)-1-oxo-1-phenylmethoxy-6-(phenylmethoxycarbonylamino)hexan-2-yl]amino]pent-1-en-3-yl]-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4S)-2,2-dimethyl-4-[(3S)-5-[[(2S)-1-oxo-1-phenylmethoxy-6-(phenylmethoxycarbonylamino)hexan-2-yl]amino]pent-1-en-3-yl]-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 11456426 |
| Molecular Formula | C36H51N3O7 |
| Molecular Weight | 637.82 g/mol |
| Exact Mass | 637.37 |
| IUPAC Name | tert-butyl (4S)-2,2-dimethyl-4-[(3S)-5-[[(2S)-1-oxo-1-phenylmethoxy-6-(phenylmethoxycarbonylamino)hexan-2-yl]amino]pent-1-en-3-yl]-1,3-oxazolidine-3-carboxylate |
| SMILES | C=C[C@H](CCN[C@@H](CCCCNC(=O)OCc1ccccc1)C(=O)OCc1ccccc1)[C@H]1COC(C)(C)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C36H51N3O7/c1-7-29(31-26-45-36(5,6)39(31)34(42)46-35(2,3)4)21-23-37-30(32(40)43-24-27-16-10-8-11-17-27)20-14-15-22-38-33(41)44-25-28-18-12-9-13-19-28/h7-13,16-19,29-31,37H,1,14-15,20-26H2,2-6H3,(H,38,41)/t29-,30+,31-/m1/s1 |
| InChIKey | IPECVIPYPGQVQK-MJSOWUPRSA-N |
| XLogP | 6.35 |
| TPSA | 115.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.82 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|