C16H17Cl2N3O3 — CID 113190879
4-[1-(3,4-dichlorophenyl)-5-oxopyrrolidine-3-carbonyl]piperazine-1-carbaldehyde (PubChem CID 113190879) has the molecular formula C16H17Cl2N3O3 and a molecular weight of 370.24 g/mol. Its IUPAC name is 4-[1-(3,4-dichlorophenyl)-5-oxopyrrolidine-3-carbonyl]piperazine-1-carbaldehyde.
| Compound Name | 4-[1-(3,4-dichlorophenyl)-5-oxopyrrolidine-3-carbonyl]piperazine-1-carbaldehyde |
|---|---|
| PubChem CID | 113190879 |
| Molecular Formula | C16H17Cl2N3O3 |
| Molecular Weight | 370.24 g/mol |
| Exact Mass | 369.06 |
| IUPAC Name | 4-[1-(3,4-dichlorophenyl)-5-oxopyrrolidine-3-carbonyl]piperazine-1-carbaldehyde |
| SMILES | O=CN1CCN(C(=O)C2CC(=O)N(c3ccc(Cl)c(Cl)c3)C2)CC1 |
| InChI | InChI=1S/C16H17Cl2N3O3/c17-13-2-1-12(8-14(13)18)21-9-11(7-15(21)23)16(24)20-5-3-19(10-22)4-6-20/h1-2,8,10-11H,3-7,9H2 |
| InChIKey | XERAIRMBCQPQKC-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.24 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|