C18H18N2O — CID 113205033
N,3,6-trimethyl-N-phenyl-1H-indole-2-carboxamide (PubChem CID 113205033) has the molecular formula C18H18N2O and a molecular weight of 278.35 g/mol. Its IUPAC name is N,3,6-trimethyl-N-phenyl-1H-indole-2-carboxamide.
| Compound Name | N,3,6-trimethyl-N-phenyl-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 113205033 |
| Molecular Formula | C18H18N2O |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | N,3,6-trimethyl-N-phenyl-1H-indole-2-carboxamide |
| SMILES | Cc1ccc2c(C)c(C(=O)N(C)c3ccccc3)[nH]c2c1 |
| InChI | InChI=1S/C18H18N2O/c1-12-9-10-15-13(2)17(19-16(15)11-12)18(21)20(3)14-7-5-4-6-8-14/h4-11,19H,1-3H3 |
| InChIKey | JARMTWUVASQORE-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|