C22H26ClN3O — CID 113214541
1-[[1-(4-chlorophenyl)cyclopropyl]methyl]-3-(4-piperidin-1-ylphenyl)urea (PubChem CID 113214541) has the molecular formula C22H26ClN3O and a molecular weight of 383.92 g/mol. Its IUPAC name is 1-[[1-(4-chlorophenyl)cyclopropyl]methyl]-3-(4-piperidin-1-ylphenyl)urea.
| Compound Name | 1-[[1-(4-chlorophenyl)cyclopropyl]methyl]-3-(4-piperidin-1-ylphenyl)urea |
|---|---|
| PubChem CID | 113214541 |
| Molecular Formula | C22H26ClN3O |
| Molecular Weight | 383.92 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | 1-[[1-(4-chlorophenyl)cyclopropyl]methyl]-3-(4-piperidin-1-ylphenyl)urea |
| SMILES | O=C(NCC1(c2ccc(Cl)cc2)CC1)Nc1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C22H26ClN3O/c23-18-6-4-17(5-7-18)22(12-13-22)16-24-21(27)25-19-8-10-20(11-9-19)26-14-2-1-3-15-26/h4-11H,1-3,12-16H2,(H2,24,25,27) |
| InChIKey | BOWGKRWWGSTAGV-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.92 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|