C18H26OSi — CID 11323644
trans-(1R,2S)-1-[2-[dimethyl(phenyl)silyl]prop-2-enyl]-2-methyl-4-methylidenecyclopentan-1-ol (PubChem CID 11323644) has the molecular formula C18H26OSi and a molecular weight of 286.49 g/mol. Its IUPAC name is trans-(1R,2S)-1-[2-[dimethyl(phenyl)silyl]prop-2-enyl]-2-methyl-4-methylidenecyclopentan-1-ol.
| Compound Name | trans-(1R,2S)-1-[2-[dimethyl(phenyl)silyl]prop-2-enyl]-2-methyl-4-methylidenecyclopentan-1-ol |
|---|---|
| PubChem CID | 11323644 |
| Molecular Formula | C18H26OSi |
| Molecular Weight | 286.49 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | trans-(1R,2S)-1-[2-[dimethyl(phenyl)silyl]prop-2-enyl]-2-methyl-4-methylidenecyclopentan-1-ol |
| SMILES | C=C1C[C@H](C)[C@](O)(CC(=C)[Si](C)(C)c2ccccc2)C1 |
| InChI | InChI=1S/C18H26OSi/c1-14-11-15(2)18(19,12-14)13-16(3)20(4,5)17-9-7-6-8-10-17/h6-10,15,19H,1,3,11-13H2,2,4-5H3/t15-,18+/m0/s1 |
| InChIKey | ZMXABZKXXLAPJE-MAUKXSAKSA-N |
| XLogP | 3.80 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.49 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|