C18H30O3 — CID 11323871
(E,7R)-7-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]tridec-5-en-8-yn-7-ol (PubChem CID 11323871) has the molecular formula C18H30O3 and a molecular weight of 294.44 g/mol. Its IUPAC name is (E,7R)-7-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]tridec-5-en-8-yn-7-ol.
| Compound Name | (E,7R)-7-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]tridec-5-en-8-yn-7-ol |
|---|---|
| PubChem CID | 11323871 |
| Molecular Formula | C18H30O3 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.22 |
| IUPAC Name | (E,7R)-7-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]tridec-5-en-8-yn-7-ol |
| SMILES | CCCCC#C[C@](O)(/C=C/CCCC)[C@@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C18H30O3/c1-5-7-9-11-13-18(19,14-12-10-8-6-2)16-15-20-17(3,4)21-16/h11,13,16,19H,5-10,15H2,1-4H3/b13-11+/t16-,18+/m0/s1 |
| InChIKey | BPAYQSJJYJWXJO-LGNMEBTLSA-N |
| XLogP | 3.81 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|