C26H29OP — CID 11326697
[[(Z)-2-[2-(cyclohexen-1-yl)ethynyl]hex-1-enyl]-phenylphosphoryl]benzene (PubChem CID 11326697) has the molecular formula C26H29OP and a molecular weight of 388.49 g/mol. Its IUPAC name is [[(Z)-2-[2-(cyclohexen-1-yl)ethynyl]hex-1-enyl]-phenylphosphoryl]benzene.
| Compound Name | [[(Z)-2-[2-(cyclohexen-1-yl)ethynyl]hex-1-enyl]-phenylphosphoryl]benzene |
|---|---|
| PubChem CID | 11326697 |
| Molecular Formula | C26H29OP |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | [[(Z)-2-[2-(cyclohexen-1-yl)ethynyl]hex-1-enyl]-phenylphosphoryl]benzene |
| SMILES | CCCC/C(C#CC1=CCCCC1)=C/P(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H29OP/c1-2-3-13-24(21-20-23-14-7-4-8-15-23)22-28(27,25-16-9-5-10-17-25)26-18-11-6-12-19-26/h5-6,9-12,14,16-19,22H,2-4,7-8,13,15H2,1H3/b24-22- |
| InChIKey | VLZZWQNGHNXRTQ-GYHWCHFESA-N |
| XLogP | 6.58 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|