C26H27OP — CID 135002903
(1-diphenylphosphoryl-3-ethylhexa-1,3-dien-2-yl)benzene (PubChem CID 135002903) has the molecular formula C26H27OP and a molecular weight of 386.48 g/mol. Its IUPAC name is (1-diphenylphosphoryl-3-ethylhexa-1,3-dien-2-yl)benzene.
| Compound Name | (1-diphenylphosphoryl-3-ethylhexa-1,3-dien-2-yl)benzene |
|---|---|
| PubChem CID | 135002903 |
| Molecular Formula | C26H27OP |
| Molecular Weight | 386.48 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | (1-diphenylphosphoryl-3-ethylhexa-1,3-dien-2-yl)benzene |
| SMILES | CCC=C(CC)C(=CP(=O)(c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H27OP/c1-3-14-22(4-2)26(23-15-8-5-9-16-23)21-28(27,24-17-10-6-11-18-24)25-19-12-7-13-20-25/h5-21H,3-4H2,1-2H3 |
| InChIKey | RMPWMQFKHCJVFJ-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.48 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|