C11H17N3OS2 — CID 113270546
2-carbamothioyl-N-(4,5-dimethyl-1,3-thiazol-2-yl)-2-methylbutanamide (PubChem CID 113270546) has the molecular formula C11H17N3OS2 and a molecular weight of 271.41 g/mol. Its IUPAC name is 2-carbamothioyl-N-(4,5-dimethyl-1,3-thiazol-2-yl)-2-methylbutanamide.
| Compound Name | 2-carbamothioyl-N-(4,5-dimethyl-1,3-thiazol-2-yl)-2-methylbutanamide |
|---|---|
| PubChem CID | 113270546 |
| Molecular Formula | C11H17N3OS2 |
| Molecular Weight | 271.41 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | 2-carbamothioyl-N-(4,5-dimethyl-1,3-thiazol-2-yl)-2-methylbutanamide |
| SMILES | CCC(C)(C(=O)Nc1nc(C)c(C)s1)C(N)=S |
| InChI | InChI=1S/C11H17N3OS2/c1-5-11(4,8(12)16)9(15)14-10-13-6(2)7(3)17-10/h5H2,1-4H3,(H2,12,16)(H,13,14,15) |
| InChIKey | VWIIVDXYQCHHCJ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.41 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|