C11H17N3O3S — CID 113270693
2-methyl-2-(2-methyl-3,5-dioxopiperazine-1-carbonyl)butanethioamide (PubChem CID 113270693) has the molecular formula C11H17N3O3S and a molecular weight of 271.34 g/mol. Its IUPAC name is 2-methyl-2-(2-methyl-3,5-dioxopiperazine-1-carbonyl)butanethioamide.
| Compound Name | 2-methyl-2-(2-methyl-3,5-dioxopiperazine-1-carbonyl)butanethioamide |
|---|---|
| PubChem CID | 113270693 |
| Molecular Formula | C11H17N3O3S |
| Molecular Weight | 271.34 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | 2-methyl-2-(2-methyl-3,5-dioxopiperazine-1-carbonyl)butanethioamide |
| SMILES | CCC(C)(C(=O)N1CC(=O)NC(=O)C1C)C(N)=S |
| InChI | InChI=1S/C11H17N3O3S/c1-4-11(3,9(12)18)10(17)14-5-7(15)13-8(16)6(14)2/h6H,4-5H2,1-3H3,(H2,12,18)(H,13,15,16) |
| InChIKey | SDMPSPKWBVORIZ-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.34 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|