C13H22N4O3 — CID 80551076
3-methyl-4-(2-methyl-2-piperazin-1-ylpropanoyl)piperazine-2,6-dione (PubChem CID 80551076) has the molecular formula C13H22N4O3 and a molecular weight of 282.34 g/mol. Its IUPAC name is 3-methyl-4-(2-methyl-2-piperazin-1-ylpropanoyl)piperazine-2,6-dione.
| Compound Name | 3-methyl-4-(2-methyl-2-piperazin-1-ylpropanoyl)piperazine-2,6-dione |
|---|---|
| PubChem CID | 80551076 |
| Molecular Formula | C13H22N4O3 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | 3-methyl-4-(2-methyl-2-piperazin-1-ylpropanoyl)piperazine-2,6-dione |
| SMILES | CC1C(=O)NC(=O)CN1C(=O)C(C)(C)N1CCNCC1 |
| InChI | InChI=1S/C13H22N4O3/c1-9-11(19)15-10(18)8-17(9)12(20)13(2,3)16-6-4-14-5-7-16/h9,14H,4-8H2,1-3H3,(H,15,18,19) |
| InChIKey | YIPBWYLOJNQDIU-UHFFFAOYSA-N |
| XLogP | -1.46 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | -1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|