C12H19N3O3S — CID 66074078
2-ethyl-2-(2-methyl-3,5-dioxopiperazine-1-carbonyl)butanethioamide (PubChem CID 66074078) has the molecular formula C12H19N3O3S and a molecular weight of 285.37 g/mol. Its IUPAC name is 2-ethyl-2-(2-methyl-3,5-dioxopiperazine-1-carbonyl)butanethioamide.
| Compound Name | 2-ethyl-2-(2-methyl-3,5-dioxopiperazine-1-carbonyl)butanethioamide |
|---|---|
| PubChem CID | 66074078 |
| Molecular Formula | C12H19N3O3S |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | 2-ethyl-2-(2-methyl-3,5-dioxopiperazine-1-carbonyl)butanethioamide |
| SMILES | CCC(CC)(C(=O)N1CC(=O)NC(=O)C1C)C(N)=S |
| InChI | InChI=1S/C12H19N3O3S/c1-4-12(5-2,10(13)19)11(18)15-6-8(16)14-9(17)7(15)3/h7H,4-6H2,1-3H3,(H2,13,19)(H,14,16,17) |
| InChIKey | KEJIJGVTNRMXBO-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|