C25H42O4Si — CID 11327992
[(1R,2S,4S)-1-[(E)-but-2-enyl]-5,6,8-trimethoxy-4,7-dimethyl-1,2,3,4-tetrahydronaphthalen-2-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 11327992) has the molecular formula C25H42O4Si and a molecular weight of 434.69 g/mol. Its IUPAC name is [(1R,2S,4S)-1-[(E)-but-2-enyl]-5,6,8-trimethoxy-4,7-dimethyl-1,2,3,4-tetrahydronaphthalen-2-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(1R,2S,4S)-1-[(E)-but-2-enyl]-5,6,8-trimethoxy-4,7-dimethyl-1,2,3,4-tetrahydronaphthalen-2-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 11327992 |
| Molecular Formula | C25H42O4Si |
| Molecular Weight | 434.69 g/mol |
| Exact Mass | 434.29 |
| IUPAC Name | [(1R,2S,4S)-1-[(E)-but-2-enyl]-5,6,8-trimethoxy-4,7-dimethyl-1,2,3,4-tetrahydronaphthalen-2-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | C/C=C/C[C@@H]1c2c(OC)c(C)c(OC)c(OC)c2[C@@H](C)C[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H42O4Si/c1-12-13-14-18-19(29-30(10,11)25(4,5)6)15-16(2)20-21(18)22(26-7)17(3)23(27-8)24(20)28-9/h12-13,16,18-19H,14-15H2,1-11H3/b13-12+/t16-,18-,19-/m0/s1 |
| InChIKey | KPZAKWRAWOYJGS-INBFNXEVSA-N |
| XLogP | 6.97 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.69 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|