C22H22O3 — CID 11336580
(2-tert-butyl-4,5-diphenylfuran-3-yl) acetate (PubChem CID 11336580) has the molecular formula C22H22O3 and a molecular weight of 334.42 g/mol. Its IUPAC name is (2-tert-butyl-4,5-diphenylfuran-3-yl) acetate.
| Compound Name | (2-tert-butyl-4,5-diphenylfuran-3-yl) acetate |
|---|---|
| PubChem CID | 11336580 |
| Molecular Formula | C22H22O3 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | (2-tert-butyl-4,5-diphenylfuran-3-yl) acetate |
| SMILES | CC(=O)Oc1c(C(C)(C)C)oc(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C22H22O3/c1-15(23)24-20-18(16-11-7-5-8-12-16)19(17-13-9-6-10-14-17)25-21(20)22(2,3)4/h5-14H,1-4H3 |
| InChIKey | DXVVEDZRUWQPIC-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |