C11H9ClIN3O2S — CID 113366071
4-cyclopropyl-5-(3-iodophenyl)-1,2,4-triazole-3-sulfonyl chloride (PubChem CID 113366071) has the molecular formula C11H9ClIN3O2S and a molecular weight of 409.64 g/mol. Its IUPAC name is 4-cyclopropyl-5-(3-iodophenyl)-1,2,4-triazole-3-sulfonyl chloride.
| Compound Name | 4-cyclopropyl-5-(3-iodophenyl)-1,2,4-triazole-3-sulfonyl chloride |
|---|---|
| PubChem CID | 113366071 |
| Molecular Formula | C11H9ClIN3O2S |
| Molecular Weight | 409.64 g/mol |
| Exact Mass | 408.91 |
| IUPAC Name | 4-cyclopropyl-5-(3-iodophenyl)-1,2,4-triazole-3-sulfonyl chloride |
| SMILES | O=S(=O)(Cl)c1nnc(-c2cccc(I)c2)n1C1CC1 |
| InChI | InChI=1S/C11H9ClIN3O2S/c12-19(17,18)11-15-14-10(16(11)9-4-5-9)7-2-1-3-8(13)6-7/h1-3,6,9H,4-5H2 |
| InChIKey | XETDLWQBBUHAGJ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 64.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.64 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|