C18H16ClNO2S — CID 11336918
4-(4-chlorophenyl)-6-methyl-4-prop-2-enylsulfanyl-1H-3,1-benzoxazin-2-one (PubChem CID 11336918) has the molecular formula C18H16ClNO2S and a molecular weight of 345.85 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-6-methyl-4-prop-2-enylsulfanyl-1H-3,1-benzoxazin-2-one.
| Compound Name | 4-(4-chlorophenyl)-6-methyl-4-prop-2-enylsulfanyl-1H-3,1-benzoxazin-2-one |
|---|---|
| PubChem CID | 11336918 |
| Molecular Formula | C18H16ClNO2S |
| Molecular Weight | 345.85 g/mol |
| Exact Mass | 345.06 |
| IUPAC Name | 4-(4-chlorophenyl)-6-methyl-4-prop-2-enylsulfanyl-1H-3,1-benzoxazin-2-one |
| SMILES | C=CCSC1(c2ccc(Cl)cc2)OC(=O)Nc2ccc(C)cc21 |
| InChI | InChI=1S/C18H16ClNO2S/c1-3-10-23-18(13-5-7-14(19)8-6-13)15-11-12(2)4-9-16(15)20-17(21)22-18/h3-9,11H,1,10H2,2H3,(H,20,21) |
| InChIKey | BIUCGEAABKHUGS-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.85 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|