C14H13ClF3NO3 — CID 127036007
(4S)-6-chloro-4-(3-methylbut-2-enoxy)-4-(trifluoromethyl)-1H-3,1-benzoxazin-2-one (PubChem CID 127036007) has the molecular formula C14H13ClF3NO3 and a molecular weight of 335.71 g/mol. Its IUPAC name is (4S)-6-chloro-4-(3-methylbut-2-enoxy)-4-(trifluoromethyl)-1H-3,1-benzoxazin-2-one.
| Compound Name | (4S)-6-chloro-4-(3-methylbut-2-enoxy)-4-(trifluoromethyl)-1H-3,1-benzoxazin-2-one |
|---|---|
| PubChem CID | 127036007 |
| Molecular Formula | C14H13ClF3NO3 |
| Molecular Weight | 335.71 g/mol |
| Exact Mass | 335.05 |
| IUPAC Name | (4S)-6-chloro-4-(3-methylbut-2-enoxy)-4-(trifluoromethyl)-1H-3,1-benzoxazin-2-one |
| SMILES | CC(C)=CCO[C@]1(C(F)(F)F)OC(=O)Nc2ccc(Cl)cc21 |
| InChI | InChI=1S/C14H13ClF3NO3/c1-8(2)5-6-21-13(14(16,17)18)10-7-9(15)3-4-11(10)19-12(20)22-13/h3-5,7H,6H2,1-2H3,(H,19,20)/t13-/m0/s1 |
| InChIKey | LNSLBESECFQUJH-ZDUSSCGKSA-N |
| XLogP | 4.60 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.71 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|