C19H31NO4Si — CID 11337525
N-benzyl-1-[(2R,4S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2-methyl-1,3-dioxan-4-yl]methanimine oxide (PubChem CID 11337525) has the molecular formula C19H31NO4Si and a molecular weight of 365.55 g/mol. Its IUPAC name is N-benzyl-1-[(2R,4S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2-methyl-1,3-dioxan-4-yl]methanimine oxide.
| Compound Name | N-benzyl-1-[(2R,4S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2-methyl-1,3-dioxan-4-yl]methanimine oxide |
|---|---|
| PubChem CID | 11337525 |
| Molecular Formula | C19H31NO4Si |
| Molecular Weight | 365.55 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | N-benzyl-1-[(2R,4S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2-methyl-1,3-dioxan-4-yl]methanimine oxide |
| SMILES | C[C@@H]1OC[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](/C=[N+](\[O-])Cc2ccccc2)O1 |
| InChI | InChI=1S/C19H31NO4Si/c1-15-22-14-18(24-25(5,6)19(2,3)4)17(23-15)13-20(21)12-16-10-8-7-9-11-16/h7-11,13,15,17-18H,12,14H2,1-6H3/b20-13-/t15-,17+,18-/m1/s1 |
| InChIKey | RIWRYMWQTUVNJO-OVVVVYFXSA-N |
| XLogP | 3.92 |
| TPSA | 53.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.55 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|