C20H33NO4Si — CID 134833763
(2S)-N-benzyl-2-[tert-butyl(dimethyl)silyl]oxy-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethanimine oxide (PubChem CID 134833763) has the molecular formula C20H33NO4Si and a molecular weight of 379.57 g/mol. Its IUPAC name is (2S)-N-benzyl-2-[tert-butyl(dimethyl)silyl]oxy-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethanimine oxide.
| Compound Name | (2S)-N-benzyl-2-[tert-butyl(dimethyl)silyl]oxy-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethanimine oxide |
|---|---|
| PubChem CID | 134833763 |
| Molecular Formula | C20H33NO4Si |
| Molecular Weight | 379.57 g/mol |
| Exact Mass | 379.22 |
| IUPAC Name | (2S)-N-benzyl-2-[tert-butyl(dimethyl)silyl]oxy-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethanimine oxide |
| SMILES | CC1(C)OC[C@@H]([C@H](/C=[N+](/[O-])Cc2ccccc2)O[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C20H33NO4Si/c1-19(2,3)26(6,7)25-17(18-15-23-20(4,5)24-18)14-21(22)13-16-11-9-8-10-12-16/h8-12,14,17-18H,13,15H2,1-7H3/b21-14+/t17-,18-/m0/s1 |
| InChIKey | DAZXBDSSOQCLDJ-VLRJIAOHSA-N |
| XLogP | 4.31 |
| TPSA | 53.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.57 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|