C14H20ClNO2 — CID 113377544
4-(chloromethyl)-2-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxy]-1,3-oxazole (PubChem CID 113377544) has the molecular formula C14H20ClNO2 and a molecular weight of 269.77 g/mol. Its IUPAC name is 4-(chloromethyl)-2-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxy]-1,3-oxazole.
| Compound Name | 4-(chloromethyl)-2-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxy]-1,3-oxazole |
|---|---|
| PubChem CID | 113377544 |
| Molecular Formula | C14H20ClNO2 |
| Molecular Weight | 269.77 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | 4-(chloromethyl)-2-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxy]-1,3-oxazole |
| SMILES | CC1(C)C2CCC1(C)C(Oc1nc(CCl)co1)C2 |
| InChI | InChI=1S/C14H20ClNO2/c1-13(2)9-4-5-14(13,3)11(6-9)18-12-16-10(7-15)8-17-12/h8-9,11H,4-7H2,1-3H3 |
| InChIKey | ULPBOUSQNJDLNY-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.77 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|