C16H21ClFNO — CID 105383886
4-(chloromethyl)-3-fluoro-2-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxy]pyridine (PubChem CID 105383886) has the molecular formula C16H21ClFNO and a molecular weight of 297.80 g/mol. Its IUPAC name is 4-(chloromethyl)-3-fluoro-2-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxy]pyridine.
| Compound Name | 4-(chloromethyl)-3-fluoro-2-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxy]pyridine |
|---|---|
| PubChem CID | 105383886 |
| Molecular Formula | C16H21ClFNO |
| Molecular Weight | 297.80 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | 4-(chloromethyl)-3-fluoro-2-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxy]pyridine |
| SMILES | CC1(C)C2CCC1(C)C(Oc1nccc(CCl)c1F)C2 |
| InChI | InChI=1S/C16H21ClFNO/c1-15(2)11-4-6-16(15,3)12(8-11)20-14-13(18)10(9-17)5-7-19-14/h5,7,11-12H,4,6,8-9H2,1-3H3 |
| InChIKey | WSZJSTDHWBLCOC-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.80 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|