C7H9N5O4S2 — CID 113383253
4-[(5-amino-1,3,4-thiadiazol-2-yl)sulfonyl]-3-methylpiperazine-2,6-dione (PubChem CID 113383253) has the molecular formula C7H9N5O4S2 and a molecular weight of 291.31 g/mol. Its IUPAC name is 4-[(5-amino-1,3,4-thiadiazol-2-yl)sulfonyl]-3-methylpiperazine-2,6-dione.
| Compound Name | 4-[(5-amino-1,3,4-thiadiazol-2-yl)sulfonyl]-3-methylpiperazine-2,6-dione |
|---|---|
| PubChem CID | 113383253 |
| Molecular Formula | C7H9N5O4S2 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.01 |
| IUPAC Name | 4-[(5-amino-1,3,4-thiadiazol-2-yl)sulfonyl]-3-methylpiperazine-2,6-dione |
| SMILES | CC1C(=O)NC(=O)CN1S(=O)(=O)c1nnc(N)s1 |
| InChI | InChI=1S/C7H9N5O4S2/c1-3-5(14)9-4(13)2-12(3)18(15,16)7-11-10-6(8)17-7/h3H,2H2,1H3,(H2,8,10)(H,9,13,14) |
| InChIKey | WPLAWPGSYCYAIY-UHFFFAOYSA-N |
| XLogP | -1.84 |
| TPSA | 135.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | -1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|