C6H10N4O2S2 — CID 82083105
5-pyrrolidin-1-ylsulfonyl-1,3,4-thiadiazol-2-amine (PubChem CID 82083105) has the molecular formula C6H10N4O2S2 and a molecular weight of 234.31 g/mol. Its IUPAC name is 5-pyrrolidin-1-ylsulfonyl-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-pyrrolidin-1-ylsulfonyl-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 82083105 |
| Molecular Formula | C6H10N4O2S2 |
| Molecular Weight | 234.31 g/mol |
| Exact Mass | 234.02 |
| IUPAC Name | 5-pyrrolidin-1-ylsulfonyl-1,3,4-thiadiazol-2-amine |
| SMILES | Nc1nnc(S(=O)(=O)N2CCCC2)s1 |
| InChI | InChI=1S/C6H10N4O2S2/c7-5-8-9-6(13-5)14(11,12)10-3-1-2-4-10/h1-4H2,(H2,7,8) |
| InChIKey | UIUCGFLHSLAVJN-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 89.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.31 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |