C8H14N4O2S2 — CID 82090856
5-(4-methylpiperidin-1-yl)sulfonyl-1,3,4-thiadiazol-2-amine (PubChem CID 82090856) has the molecular formula C8H14N4O2S2 and a molecular weight of 262.36 g/mol. Its IUPAC name is 5-(4-methylpiperidin-1-yl)sulfonyl-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-(4-methylpiperidin-1-yl)sulfonyl-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 82090856 |
| Molecular Formula | C8H14N4O2S2 |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.06 |
| IUPAC Name | 5-(4-methylpiperidin-1-yl)sulfonyl-1,3,4-thiadiazol-2-amine |
| SMILES | CC1CCN(S(=O)(=O)c2nnc(N)s2)CC1 |
| InChI | InChI=1S/C8H14N4O2S2/c1-6-2-4-12(5-3-6)16(13,14)8-11-10-7(9)15-8/h6H,2-5H2,1H3,(H2,9,10) |
| InChIKey | WFSNKJXCGXXWOL-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 89.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |