C8H13N3O4S — CID 114810209
N-cyclopropyl-2-methyl-3,5-dioxopiperazine-1-sulfonamide (PubChem CID 114810209) has the molecular formula C8H13N3O4S and a molecular weight of 247.28 g/mol. Its IUPAC name is N-cyclopropyl-2-methyl-3,5-dioxopiperazine-1-sulfonamide.
| Compound Name | N-cyclopropyl-2-methyl-3,5-dioxopiperazine-1-sulfonamide |
|---|---|
| PubChem CID | 114810209 |
| Molecular Formula | C8H13N3O4S |
| Molecular Weight | 247.28 g/mol |
| Exact Mass | 247.06 |
| IUPAC Name | N-cyclopropyl-2-methyl-3,5-dioxopiperazine-1-sulfonamide |
| SMILES | CC1C(=O)NC(=O)CN1S(=O)(=O)NC1CC1 |
| InChI | InChI=1S/C8H13N3O4S/c1-5-8(13)9-7(12)4-11(5)16(14,15)10-6-2-3-6/h5-6,10H,2-4H2,1H3,(H,9,12,13) |
| InChIKey | RGSCYOREOWBZIR-UHFFFAOYSA-N |
| XLogP | -1.67 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.28 |
| LogP ≤ 5 | -1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|