C10H16N2O5S — CID 66063734
3-methyl-4-(oxan-4-ylsulfonyl)piperazine-2,6-dione (PubChem CID 66063734) has the molecular formula C10H16N2O5S and a molecular weight of 276.31 g/mol. Its IUPAC name is 3-methyl-4-(oxan-4-ylsulfonyl)piperazine-2,6-dione.
| Compound Name | 3-methyl-4-(oxan-4-ylsulfonyl)piperazine-2,6-dione |
|---|---|
| PubChem CID | 66063734 |
| Molecular Formula | C10H16N2O5S |
| Molecular Weight | 276.31 g/mol |
| Exact Mass | 276.08 |
| IUPAC Name | 3-methyl-4-(oxan-4-ylsulfonyl)piperazine-2,6-dione |
| SMILES | CC1C(=O)NC(=O)CN1S(=O)(=O)C1CCOCC1 |
| InChI | InChI=1S/C10H16N2O5S/c1-7-10(14)11-9(13)6-12(7)18(15,16)8-2-4-17-5-3-8/h7-8H,2-6H2,1H3,(H,11,13,14) |
| InChIKey | RUVZEXINTPWIJV-UHFFFAOYSA-N |
| XLogP | -1.16 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.31 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|